C14H18ClN3OS — CID 86612097
3-[(2-chlorophenyl)-hydroxymethyl]-4-(2-methylbutyl)-1H-1,2,4-triazole-5-thione (PubChem CID 86612097) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)-hydroxymethyl]-4-(2-methylbutyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2-chlorophenyl)-hydroxymethyl]-4-(2-methylbutyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 86612097 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-[(2-chlorophenyl)-hydroxymethyl]-4-(2-methylbutyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCC(C)Cn1c(C(O)c2ccccc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C14H18ClN3OS/c1-3-9(2)8-18-13(16-17-14(18)20)12(19)10-6-4-5-7-11(10)15/h4-7,9,12,19H,3,8H2,1-2H3,(H,17,20) |
| InChIKey | LZECVARMEUVYJI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|