C21H17F5O4S2 — CID 86612198
1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate;triphenylsulfanium (PubChem CID 86612198) has the molecular formula C21H17F5O4S2 and a molecular weight of 492.49 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86612198 |
| Molecular Formula | C21H17F5O4S2 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(O)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C3H3F5O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4-2(5,6)1(9)3(7,8)13(10,11)12/h1-15H;1,9H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | XNDQSSKLGQJIHB-UHFFFAOYSA-M |
| XLogP | 4.83 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|