C20H19F5N2 — CID 86612281
2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropyl)phenyl]methyl]ethanamine (PubChem CID 86612281) has the molecular formula C20H19F5N2 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropyl)phenyl]methyl]ethanamine.
| Compound Name | 2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 86612281 |
| Molecular Formula | C20H19F5N2 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropyl)phenyl]methyl]ethanamine |
| SMILES | Fc1ccc2c(CCNCc3cccc(CC(F)(F)C(F)F)c3)c[nH]c2c1 |
| InChI | InChI=1S/C20H19F5N2/c21-16-4-5-17-15(12-27-18(17)9-16)6-7-26-11-14-3-1-2-13(8-14)10-20(24,25)19(22)23/h1-5,8-9,12,19,26-27H,6-7,10-11H2 |
| InChIKey | ZYPVVJZQNXBWRZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|