C14H24O6 — CID 86612453
tert-butyl 2-[[(4S,5S)-2-ethyl-5-formyl-2-methyl-1,3-dioxolan-4-yl]methoxy]acetate (PubChem CID 86612453) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is tert-butyl 2-[[(4S,5S)-2-ethyl-5-formyl-2-methyl-1,3-dioxolan-4-yl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[(4S,5S)-2-ethyl-5-formyl-2-methyl-1,3-dioxolan-4-yl]methoxy]acetate |
|---|---|
| PubChem CID | 86612453 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | tert-butyl 2-[[(4S,5S)-2-ethyl-5-formyl-2-methyl-1,3-dioxolan-4-yl]methoxy]acetate |
| SMILES | CCC1(C)O[C@@H](COCC(=O)OC(C)(C)C)[C@@H](C=O)O1 |
| InChI | InChI=1S/C14H24O6/c1-6-14(5)18-10(7-15)11(19-14)8-17-9-12(16)20-13(2,3)4/h7,10-11H,6,8-9H2,1-5H3/t10-,11+,14?/m1/s1 |
| InChIKey | GDGGYNURAHJZSW-ZAZPPBBNSA-N |
| XLogP | 1.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|