About [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate
[(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate (PubChem CID 86612733) has the molecular formula C24H34O5S
and a molecular weight of 434.60 g/mol. Its IUPAC name is [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate |
| PubChem CID | 86612733 |
| Molecular Formula | C24H34O5S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)CCCCCC[C@H](C)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H34O5S/c1-20-14-16-24(17-15-20)30(26,27)29-19-23(25)13-9-4-3-6-10-21(2)28-18-22-11-7-5-8-12-22/h5,7-8,11-12,14-17,21,23,25H,3-4,6,9-10,13,18-19H2,1-2H3/t21-,23+/m0/s1 |
| InChIKey | ADVQNKKUACFJPY-JTHBVZDNSA-N |
| XLogP | 5.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate?
The IUPAC name of [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate (CID 86612733) is [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate?
The canonical SMILES for [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC[C@H](O)CCCCCC[C@H](C)OCc2ccccc2)cc1.
What is the InChIKey of [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate?
The InChIKey is ADVQNKKUACFJPY-JTHBVZDNSA-N. The full InChI is InChI=1S/C24H34O5S/c1-20-14-16-24(17-15-20)30(26,27)29-19-23(25)13-9-4-3-6-10-21(2)28-18-22-11-7-5-8-12-22/h5,7-8,11-12,14-17,21,23,25H,3-4,6,9-10,13,18-19H2,1-2H3/t21-,23+/m0/s1.
What are the key properties of [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate?
[(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate has a molecular weight of 434.60 g/mol, XLogP of 5.01, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,9S)-2-hydroxy-9-phenylmethoxydecyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 86612733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).