C22H24Cl2FOTi- — CID 86612917
dichlorotitanium;4-fluoro-2-phenylphenol;1,2,3,5,5-pentamethylcyclopenta-1,3-diene (PubChem CID 86612917) has the molecular formula C22H24Cl2FOTi- and a molecular weight of 442.20 g/mol. Its IUPAC name is dichlorotitanium;4-fluoro-2-phenylphenol;1,2,3,5,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | dichlorotitanium;4-fluoro-2-phenylphenol;1,2,3,5,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 86612917 |
| Molecular Formula | C22H24Cl2FOTi- |
| Molecular Weight | 442.20 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | dichlorotitanium;4-fluoro-2-phenylphenol;1,2,3,5,5-pentamethylcyclopenta-1,3-diene |
| SMILES | CC1=[C-]C(C)(C)C(C)=C1C.Cl[Ti]Cl.Oc1ccc(F)cc1-c1ccccc1 |
| InChI | InChI=1S/C12H9FO.C10H15.2ClH.Ti/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9;1-7-6-10(4,5)9(3)8(7)2;;;/h1-8,14H;1-5H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | MPGUCRKQYFMWKV-UHFFFAOYSA-L |
| XLogP | 7.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.20 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|