About N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide
N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide (PubChem CID 86613071) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide.
Molecular Properties
| Compound Name | N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide |
| PubChem CID | 86613071 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide |
| SMILES | CCCCCCCC(=O)N/N=C\CC(C)CC(C)(C)C |
| InChI | InChI=1S/C17H34N2O/c1-6-7-8-9-10-11-16(20)19-18-13-12-15(2)14-17(3,4)5/h13,15H,6-12,14H2,1-5H3,(H,19,20)/b18-13- |
| InChIKey | PNSPSCJBNXGHJR-AQTBWJFISA-N |
| XLogP | 4.91 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide?
The IUPAC name of N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide (CID 86613071) is N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide.
What is the SMILES notation for N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide?
The canonical SMILES for N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide is CCCCCCCC(=O)N/N=C\CC(C)CC(C)(C)C.
What is the InChIKey of N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide?
The InChIKey is PNSPSCJBNXGHJR-AQTBWJFISA-N. The full InChI is InChI=1S/C17H34N2O/c1-6-7-8-9-10-11-16(20)19-18-13-12-15(2)14-17(3,4)5/h13,15H,6-12,14H2,1-5H3,(H,19,20)/b18-13-.
What are the key properties of N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide?
N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide has a molecular weight of 282.47 g/mol, XLogP of 4.91, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-3,5,5-trimethylhexylideneamino]octanamide is sourced from PubChem (CID 86613071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).