C27H24N6O2 — CID 86613318
3-[4-[4-[2-(4-formylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-methylpyrazol-3-yl]phenyl]-1,1-dimethylurea (PubChem CID 86613318) has the molecular formula C27H24N6O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 3-[4-[4-[2-(4-formylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-methylpyrazol-3-yl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[4-[2-(4-formylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-methylpyrazol-3-yl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 86613318 |
| Molecular Formula | C27H24N6O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 3-[4-[4-[2-(4-formylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-methylpyrazol-3-yl]phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(-c2nn(C)cc2-c2ccnc3[nH]c(-c4ccc(C=O)cc4)cc23)cc1 |
| InChI | InChI=1S/C27H24N6O2/c1-32(2)27(35)29-20-10-8-19(9-11-20)25-23(15-33(3)31-25)21-12-13-28-26-22(21)14-24(30-26)18-6-4-17(16-34)5-7-18/h4-16H,1-3H3,(H,28,30)(H,29,35) |
| InChIKey | UUJDFTVNWVRYMK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|