About [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate
[2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate (PubChem CID 86613923) has the molecular formula C29H22F3NO4S
and a molecular weight of 537.56 g/mol. Its IUPAC name is [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate |
| PubChem CID | 86613923 |
| Molecular Formula | C29H22F3NO4S |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate |
| SMILES | O=C1CCc2c(OS(=O)(=O)C(F)(F)F)ccc(-c3ccccc3)c2N1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H22F3NO4S/c30-29(31,32)38(35,36)37-26-17-15-24(23-9-5-2-6-10-23)28-25(26)16-18-27(34)33(28)19-20-11-13-22(14-12-20)21-7-3-1-4-8-21/h1-15,17H,16,18-19H2 |
| InChIKey | OIWANIRLCWRYMJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate?
The IUPAC name of [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate (CID 86613923) is [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate.
What is the SMILES notation for [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate?
The canonical SMILES for [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate is O=C1CCc2c(OS(=O)(=O)C(F)(F)F)ccc(-c3ccccc3)c2N1Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate?
The InChIKey is OIWANIRLCWRYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22F3NO4S/c30-29(31,32)38(35,36)37-26-17-15-24(23-9-5-2-6-10-23)28-25(26)16-18-27(34)33(28)19-20-11-13-22(14-12-20)21-7-3-1-4-8-21/h1-15,17H,16,18-19H2.
What are the key properties of [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate?
[2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate has a molecular weight of 537.56 g/mol, XLogP of 6.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] trifluoromethanesulfonate is sourced from PubChem (CID 86613923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).