C20H33ClFNO3SSi — CID 86614116
(S)-N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-chloro-5-fluorophenyl)-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 86614116) has the molecular formula C20H33ClFNO3SSi and a molecular weight of 450.09 g/mol. Its IUPAC name is (S)-N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-chloro-5-fluorophenyl)-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-chloro-5-fluorophenyl)-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 86614116 |
| Molecular Formula | C20H33ClFNO3SSi |
| Molecular Weight | 450.09 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (S)-N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-chloro-5-fluorophenyl)-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N[C@@H](Cc1cc(F)cc(Cl)c1)[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33ClFNO3SSi/c1-19(2,3)27(25)23-17(11-14-9-15(21)12-16(22)10-14)18(13-24)26-28(7,8)20(4,5)6/h9-10,12-13,17-18,23H,11H2,1-8H3/t17-,18+,27-/m0/s1 |
| InChIKey | QGLODLGPUIVSBH-WNGDZKDKSA-N |
| XLogP | 5.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.09 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|