About 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate
5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate (PubChem CID 86614156) has the molecular formula C7H5F3N2O4S
and a molecular weight of 270.19 g/mol. Its IUPAC name is 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate |
| PubChem CID | 86614156 |
| Molecular Formula | C7H5F3N2O4S |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(nn1)OCC2)C(F)(F)F |
| InChI | InChI=1S/C7H5F3N2O4S/c8-7(9,10)17(13,14)16-5-3-4-1-2-15-6(4)12-11-5/h3H,1-2H2 |
| InChIKey | JIHSGEXGIHZHBF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate?
The IUPAC name of 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate (CID 86614156) is 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate.
What is the SMILES notation for 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate?
The canonical SMILES for 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate is O=S(=O)(Oc1cc2c(nn1)OCC2)C(F)(F)F.
What is the InChIKey of 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate?
The InChIKey is JIHSGEXGIHZHBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3N2O4S/c8-7(9,10)17(13,14)16-5-3-4-1-2-15-6(4)12-11-5/h3H,1-2H2.
What are the key properties of 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate?
5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate has a molecular weight of 270.19 g/mol, XLogP of 0.64, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydrofuro[2,3-c]pyridazin-3-yl trifluoromethanesulfonate is sourced from PubChem (CID 86614156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).