C11H8ClF3N4O3 — CID 86614278
N-[2-[(3-chloro-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 86614278) has the molecular formula C11H8ClF3N4O3 and a molecular weight of 336.66 g/mol. Its IUPAC name is N-[2-[(3-chloro-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[(3-chloro-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 86614278 |
| Molecular Formula | C11H8ClF3N4O3 |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | N-[2-[(3-chloro-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCOc1ccc2nc(Cl)n[n+]([O-])c2c1)C(F)(F)F |
| InChI | InChI=1S/C11H8ClF3N4O3/c12-10-17-7-2-1-6(5-8(7)19(21)18-10)22-4-3-16-9(20)11(13,14)15/h1-2,5H,3-4H2,(H,16,20) |
| InChIKey | RVUNNZLRQUNQMR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|