C8H8F9NO3S — CID 86614459
1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-(oxiran-2-ylmethyl)butane-1-sulfonamide (PubChem CID 86614459) has the molecular formula C8H8F9NO3S and a molecular weight of 369.21 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-(oxiran-2-ylmethyl)butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-(oxiran-2-ylmethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 86614459 |
| Molecular Formula | C8H8F9NO3S |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-(oxiran-2-ylmethyl)butane-1-sulfonamide |
| SMILES | CN(CC1CO1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F9NO3S/c1-18(2-4-3-21-4)22(19,20)8(16,17)6(11,12)5(9,10)7(13,14)15/h4H,2-3H2,1H3 |
| InChIKey | WUHMJNPEZIJSEW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|