C13H14BrF2NO2 — CID 86614497
5-bromo-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluorobenzaldehyde (PubChem CID 86614497) has the molecular formula C13H14BrF2NO2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 5-bromo-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluorobenzaldehyde.
| Compound Name | 5-bromo-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluorobenzaldehyde |
|---|---|
| PubChem CID | 86614497 |
| Molecular Formula | C13H14BrF2NO2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 5-bromo-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluorobenzaldehyde |
| SMILES | C[C@@H]1CN(c2c(C=O)cc(Br)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C13H14BrF2NO2/c1-7-4-17(5-8(2)19-7)13-9(6-18)3-10(14)11(15)12(13)16/h3,6-8H,4-5H2,1-2H3/t7-,8+ |
| InChIKey | ZEKMMJFJVSCFLO-OCAPTIKFSA-N |
| XLogP | 3.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|