About 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde
5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde (PubChem CID 86614500) has the molecular formula C13H14BrF2NO2
and a molecular weight of 334.16 g/mol. Its IUPAC name is 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde |
| PubChem CID | 86614500 |
| Molecular Formula | C13H14BrF2NO2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde |
| SMILES | CC1CN(c2c(C=O)cc(Br)c(F)c2F)CC(C)O1 |
| InChI | InChI=1S/C13H14BrF2NO2/c1-7-4-17(5-8(2)19-7)13-9(6-18)3-10(14)11(15)12(13)16/h3,6-8H,4-5H2,1-2H3 |
| InChIKey | ZEKMMJFJVSCFLO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde?
The IUPAC name of 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde (CID 86614500) is 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde.
What is the SMILES notation for 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde?
The canonical SMILES for 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde is CC1CN(c2c(C=O)cc(Br)c(F)c2F)CC(C)O1.
What is the InChIKey of 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde?
The InChIKey is ZEKMMJFJVSCFLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrF2NO2/c1-7-4-17(5-8(2)19-7)13-9(6-18)3-10(14)11(15)12(13)16/h3,6-8H,4-5H2,1-2H3.
What are the key properties of 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde?
5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde has a molecular weight of 334.16 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(2,6-dimethylmorpholin-4-yl)-3,4-difluorobenzaldehyde is sourced from PubChem (CID 86614500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).