C11H8F7N5 — CID 86614625
N'-[5-cyano-2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 86614625) has the molecular formula C11H8F7N5 and a molecular weight of 343.21 g/mol. Its IUPAC name is N'-[5-cyano-2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-cyano-2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 86614625 |
| Molecular Formula | C11H8F7N5 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N'-[5-cyano-2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nc(C(F)(F)C(F)(F)C(F)(F)F)ncc1C#N |
| InChI | InChI=1S/C11H8F7N5/c1-23(2)5-21-7-6(3-19)4-20-8(22-7)9(12,13)10(14,15)11(16,17)18/h4-5H,1-2H3/b21-5+ |
| InChIKey | XEKCUPIFROZPAG-IGCPIRJNSA-N |
| XLogP | 2.86 |
| TPSA | 65.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|