C8H3F7N4 — CID 86614626
4-amino-2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidine-5-carbonitrile (PubChem CID 86614626) has the molecular formula C8H3F7N4 and a molecular weight of 288.13 g/mol. Its IUPAC name is 4-amino-2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 86614626 |
| Molecular Formula | C8H3F7N4 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-amino-2-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(C(F)(F)C(F)(F)C(F)(F)F)nc1N |
| InChI | InChI=1S/C8H3F7N4/c9-6(10,7(11,12)8(13,14)15)5-18-2-3(1-16)4(17)19-5/h2H,(H2,17,18,19) |
| InChIKey | LULYEDKAPUSTAC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|