About [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid
[1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid (PubChem CID 86614924) has the molecular formula C8H15NO6S2
and a molecular weight of 285.34 g/mol. Its IUPAC name is [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid.
Molecular Properties
| Compound Name | [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid |
| PubChem CID | 86614924 |
| Molecular Formula | C8H15NO6S2 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)OCC1(CC#N)CC1 |
| InChI | InChI=1S/C7H11NO3S.CH4O3S/c1-12(9,10)11-6-7(2-3-7)4-5-8;1-5(2,3)4/h2-4,6H2,1H3;1H3,(H,2,3,4) |
| InChIKey | WHQORIUVKHYWNW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid?
The IUPAC name of [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid (CID 86614924) is [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid.
What is the SMILES notation for [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid?
The canonical SMILES for [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid is CS(=O)(=O)O.CS(=O)(=O)OCC1(CC#N)CC1.
What is the InChIKey of [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid?
The InChIKey is WHQORIUVKHYWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S.CH4O3S/c1-12(9,10)11-6-7(2-3-7)4-5-8;1-5(2,3)4/h2-4,6H2,1H3;1H3,(H,2,3,4).
What are the key properties of [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid?
[1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid has a molecular weight of 285.34 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(cyanomethyl)cyclopropyl]methyl methanesulfonate;methanesulfonic acid is sourced from PubChem (CID 86614924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).