About 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate
4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate (PubChem CID 86615155) has the molecular formula C13H16FNO4S
and a molecular weight of 301.34 g/mol. Its IUPAC name is 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate.
Molecular Properties
| Compound Name | 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate |
| PubChem CID | 86615155 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCCC1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C13H16FNO4S/c1-20(17,18)19-7-3-2-4-10-11-8-9(14)5-6-12(11)15-13(10)16/h5-6,8,10H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | IDJPRAFVIQWUTR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate?
The IUPAC name of 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate (CID 86615155) is 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate.
What is the SMILES notation for 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate?
The canonical SMILES for 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate is CS(=O)(=O)OCCCCC1C(=O)Nc2ccc(F)cc21.
What is the InChIKey of 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate?
The InChIKey is IDJPRAFVIQWUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO4S/c1-20(17,18)19-7-3-2-4-10-11-8-9(14)5-6-12(11)15-13(10)16/h5-6,8,10H,2-4,7H2,1H3,(H,15,16).
What are the key properties of 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate?
4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate has a molecular weight of 301.34 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)butyl methanesulfonate is sourced from PubChem (CID 86615155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).