C28H18F6O4S2 — CID 86615282
3,5-bis(trifluoromethyl)benzenesulfonate;10-(2-methylphenyl)thioxanthen-10-ium-9-one (PubChem CID 86615282) has the molecular formula C28H18F6O4S2 and a molecular weight of 596.57 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)benzenesulfonate;10-(2-methylphenyl)thioxanthen-10-ium-9-one.
| Compound Name | 3,5-bis(trifluoromethyl)benzenesulfonate;10-(2-methylphenyl)thioxanthen-10-ium-9-one |
|---|---|
| PubChem CID | 86615282 |
| Molecular Formula | C28H18F6O4S2 |
| Molecular Weight | 596.57 g/mol |
| Exact Mass | 596.06 |
| IUPAC Name | 3,5-bis(trifluoromethyl)benzenesulfonate;10-(2-methylphenyl)thioxanthen-10-ium-9-one |
| SMILES | Cc1ccccc1-[s+]1c2ccccc2c(=O)c2ccccc21.O=S(=O)([O-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15OS.C8H4F6O3S/c1-14-8-2-5-11-17(14)22-18-12-6-3-9-15(18)20(21)16-10-4-7-13-19(16)22;9-7(10,11)4-1-5(8(12,13)14)3-6(2-4)18(15,16)17/h2-13H,1H3;1-3H,(H,15,16,17)/q+1;/p-1 |
| InChIKey | RGBPZOUVHGUPTO-UHFFFAOYSA-M |
| XLogP | 8.03 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.57 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|