C20H21ClN4O5 — CID 86615425
2-[1-[2-chloro-4-(2-hydroxyethoxy)benzoyl]-3-oxo-2,5-dihydro-1,4-benzodiazepin-4-yl]-N'-hydroxyethanimidamide (PubChem CID 86615425) has the molecular formula C20H21ClN4O5 and a molecular weight of 432.86 g/mol. Its IUPAC name is 2-[1-[2-chloro-4-(2-hydroxyethoxy)benzoyl]-3-oxo-2,5-dihydro-1,4-benzodiazepin-4-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[2-chloro-4-(2-hydroxyethoxy)benzoyl]-3-oxo-2,5-dihydro-1,4-benzodiazepin-4-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 86615425 |
| Molecular Formula | C20H21ClN4O5 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-[1-[2-chloro-4-(2-hydroxyethoxy)benzoyl]-3-oxo-2,5-dihydro-1,4-benzodiazepin-4-yl]-N'-hydroxyethanimidamide |
| SMILES | NC(CN1Cc2ccccc2N(C(=O)c2ccc(OCCO)cc2Cl)CC1=O)=NO |
| InChI | InChI=1S/C20H21ClN4O5/c21-16-9-14(30-8-7-26)5-6-15(16)20(28)25-12-19(27)24(11-18(22)23-29)10-13-3-1-2-4-17(13)25/h1-6,9,26,29H,7-8,10-12H2,(H2,22,23) |
| InChIKey | HIKRMAXDAUJVFM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|