C29H27F3N2O3S — CID 86615467
2,2-dimethylpropyl 3-[6-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]benzenesulfonate (PubChem CID 86615467) has the molecular formula C29H27F3N2O3S and a molecular weight of 540.61 g/mol. Its IUPAC name is 2,2-dimethylpropyl 3-[6-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]benzenesulfonate.
| Compound Name | 2,2-dimethylpropyl 3-[6-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]benzenesulfonate |
|---|---|
| PubChem CID | 86615467 |
| Molecular Formula | C29H27F3N2O3S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 2,2-dimethylpropyl 3-[6-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]benzenesulfonate |
| SMILES | Cc1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2cccc(-c3cccc(S(=O)(=O)OCC(C)(C)C)c3)n2)n1 |
| InChI | InChI=1S/C29H27F3N2O3S/c1-19-15-22(20-11-13-23(14-12-20)29(30,31)32)17-27(33-19)26-10-6-9-25(34-26)21-7-5-8-24(16-21)38(35,36)37-18-28(2,3)4/h5-17H,18H2,1-4H3 |
| InChIKey | WVKROVAUAXUXDQ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|