C25H24N4O4 — CID 86615536
methyl (2R)-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoate (PubChem CID 86615536) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is methyl (2R)-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoate.
| Compound Name | methyl (2R)-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoate |
|---|---|
| PubChem CID | 86615536 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | methyl (2R)-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoate |
| SMILES | COC(=O)[C@@H](C)Oc1cccc2ncnc(Nc3ccc(OCc4ccccn4)c(C)c3)c12 |
| InChI | InChI=1S/C25H24N4O4/c1-16-13-18(10-11-21(16)32-14-19-7-4-5-12-26-19)29-24-23-20(27-15-28-24)8-6-9-22(23)33-17(2)25(30)31-3/h4-13,15,17H,14H2,1-3H3,(H,27,28,29)/t17-/m1/s1 |
| InChIKey | RWVBQNQYSPMONT-QGZVFWFLSA-N |
| XLogP | 4.60 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |