About (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride
(2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride (PubChem CID 86616001) has the molecular formula C5H8ClF6NO
and a molecular weight of 247.57 g/mol. Its IUPAC name is (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride |
| PubChem CID | 86616001 |
| Molecular Formula | C5H8ClF6NO |
| Molecular Weight | 247.57 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](CO)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H7F6NO.ClH/c6-4(7,8)3(2(12)1-13)5(9,10)11;/h2-3,13H,1,12H2;1H/t2-;/m1./s1 |
| InChIKey | XMDVECIYXBBJNB-HSHFZTNMSA-N |
| XLogP | 1.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride?
The IUPAC name of (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride (CID 86616001) is (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride.
What is the SMILES notation for (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride?
The canonical SMILES for (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride is Cl.N[C@H](CO)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride?
The InChIKey is XMDVECIYXBBJNB-HSHFZTNMSA-N. The full InChI is InChI=1S/C5H7F6NO.ClH/c6-4(7,8)3(2(12)1-13)5(9,10)11;/h2-3,13H,1,12H2;1H/t2-;/m1./s1.
What are the key properties of (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride?
(2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride has a molecular weight of 247.57 g/mol, XLogP of 1.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butan-1-ol;hydrochloride is sourced from PubChem (CID 86616001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).