C13H13BrF3NO — CID 86616392
6-(6-bromo-2,3,4-trifluorophenyl)-3,3-dimethylpiperidin-2-one (PubChem CID 86616392) has the molecular formula C13H13BrF3NO and a molecular weight of 336.15 g/mol. Its IUPAC name is 6-(6-bromo-2,3,4-trifluorophenyl)-3,3-dimethylpiperidin-2-one.
| Compound Name | 6-(6-bromo-2,3,4-trifluorophenyl)-3,3-dimethylpiperidin-2-one |
|---|---|
| PubChem CID | 86616392 |
| Molecular Formula | C13H13BrF3NO |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 6-(6-bromo-2,3,4-trifluorophenyl)-3,3-dimethylpiperidin-2-one |
| SMILES | CC1(C)CCC(c2c(Br)cc(F)c(F)c2F)NC1=O |
| InChI | InChI=1S/C13H13BrF3NO/c1-13(2)4-3-8(18-12(13)19)9-6(14)5-7(15)10(16)11(9)17/h5,8H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | CAYSDWAWBFXSBN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|