C21H20FN5O3S — CID 86616631
2-[5-[2-fluoro-5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]phenyl]-1H-imidazol-2-yl]ethyl methanesulfonate (PubChem CID 86616631) has the molecular formula C21H20FN5O3S and a molecular weight of 441.49 g/mol. Its IUPAC name is 2-[5-[2-fluoro-5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]phenyl]-1H-imidazol-2-yl]ethyl methanesulfonate.
| Compound Name | 2-[5-[2-fluoro-5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]phenyl]-1H-imidazol-2-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 86616631 |
| Molecular Formula | C21H20FN5O3S |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[5-[2-fluoro-5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]phenyl]-1H-imidazol-2-yl]ethyl methanesulfonate |
| SMILES | Cc1cccc(-c2[nH]ncc2-c2ccc(F)c(-c3cnc(CCOS(C)(=O)=O)[nH]3)c2)n1 |
| InChI | InChI=1S/C21H20FN5O3S/c1-13-4-3-5-18(25-13)21-16(11-24-27-21)14-6-7-17(22)15(10-14)19-12-23-20(26-19)8-9-30-31(2,28)29/h3-7,10-12H,8-9H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | SLKDXEAGNXSYIZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|