C34H35F3O9 — CID 86617414
tert-butyl 6-[[4-[2-formyl-4-(2-methoxy-2-oxoethyl)phenyl]phenoxy]methyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-(trifluoromethyl)benzoate (PubChem CID 86617414) has the molecular formula C34H35F3O9 and a molecular weight of 644.64 g/mol. Its IUPAC name is tert-butyl 6-[[4-[2-formyl-4-(2-methoxy-2-oxoethyl)phenyl]phenoxy]methyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-(trifluoromethyl)benzoate.
| Compound Name | tert-butyl 6-[[4-[2-formyl-4-(2-methoxy-2-oxoethyl)phenyl]phenoxy]methyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 86617414 |
| Molecular Formula | C34H35F3O9 |
| Molecular Weight | 644.64 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | tert-butyl 6-[[4-[2-formyl-4-(2-methoxy-2-oxoethyl)phenyl]phenoxy]methyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-(trifluoromethyl)benzoate |
| SMILES | COC(=O)Cc1ccc(-c2ccc(OCc3ccc(C(F)(F)F)c(OC(=O)OC(C)(C)C)c3C(=O)OC(C)(C)C)cc2)c(C=O)c1 |
| InChI | InChI=1S/C34H35F3O9/c1-32(2,3)45-30(40)28-22(11-15-26(34(35,36)37)29(28)44-31(41)46-33(4,5)6)19-43-24-12-9-21(10-13-24)25-14-8-20(16-23(25)18-38)17-27(39)42-7/h8-16,18H,17,19H2,1-7H3 |
| InChIKey | ZHFUOWCZNDCGRS-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.64 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|