C14H16ClN3O2 — CID 86617457
3-(2-morpholin-4-ylethyl)imidazo[1,5-a]pyridine-1-carbonyl chloride (PubChem CID 86617457) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is 3-(2-morpholin-4-ylethyl)imidazo[1,5-a]pyridine-1-carbonyl chloride.
| Compound Name | 3-(2-morpholin-4-ylethyl)imidazo[1,5-a]pyridine-1-carbonyl chloride |
|---|---|
| PubChem CID | 86617457 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 3-(2-morpholin-4-ylethyl)imidazo[1,5-a]pyridine-1-carbonyl chloride |
| SMILES | O=C(Cl)c1nc(CCN2CCOCC2)n2ccccc12 |
| InChI | InChI=1S/C14H16ClN3O2/c15-14(19)13-11-3-1-2-5-18(11)12(16-13)4-6-17-7-9-20-10-8-17/h1-3,5H,4,6-10H2 |
| InChIKey | PLEMVUANYNAOBC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|