C27H39BF4N2 — CID 86617852
1,3-bis(2,6-dipropylphenyl)-4,5-dihydroimidazol-1-ium tetrafluoroborate (PubChem CID 86617852) has the molecular formula C27H39BF4N2 and a molecular weight of 478.43 g/mol. Its IUPAC name is 1,3-bis(2,6-dipropylphenyl)-4,5-dihydroimidazol-1-ium tetrafluoroborate.
| Compound Name | 1,3-bis(2,6-dipropylphenyl)-4,5-dihydroimidazol-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 86617852 |
| Molecular Formula | C27H39BF4N2 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 1,3-bis(2,6-dipropylphenyl)-4,5-dihydroimidazol-1-ium tetrafluoroborate |
| SMILES | CCCc1cccc(CCC)c1N1C=[N+](c2c(CCC)cccc2CCC)CC1.F[B-](F)(F)F |
| InChI | InChI=1S/C27H39N2.BF4/c1-5-11-22-15-9-16-23(12-6-2)26(22)28-19-20-29(21-28)27-24(13-7-3)17-10-18-25(27)14-8-4;2-1(3,4)5/h9-10,15-18,21H,5-8,11-14,19-20H2,1-4H3;/q+1;-1 |
| InChIKey | BXWKOTAWMLLTKA-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|