C18H24F6O3 — CID 86618068
[1,1,1,3,3,3-hexafluoro-2-[[3-(2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-yl] 2-methylprop-2-enoate (PubChem CID 86618068) has the molecular formula C18H24F6O3 and a molecular weight of 402.38 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[[3-(2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[[3-(2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 86618068 |
| Molecular Formula | C18H24F6O3 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[[3-(2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC1C2CCC(C2)C1C(C)(C)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H24F6O3/c1-9(2)14(25)27-16(17(19,20)21,18(22,23)24)8-12-10-5-6-11(7-10)13(12)15(3,4)26/h10-13,26H,1,5-8H2,2-4H3 |
| InChIKey | NRUMGMZKYCADTF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|