C19H32IN3O3Si — CID 86618720
N-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-iodopyrimidin-4-amine (PubChem CID 86618720) has the molecular formula C19H32IN3O3Si and a molecular weight of 505.47 g/mol. Its IUPAC name is N-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-iodopyrimidin-4-amine.
| Compound Name | N-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 86618720 |
| Molecular Formula | C19H32IN3O3Si |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | N-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-iodopyrimidin-4-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](Nc3cc(I)ncn3)[C@@H]2O1 |
| InChI | InChI=1S/C19H32IN3O3Si/c1-18(2,3)27(6,7)24-10-12-8-13(17-16(12)25-19(4,5)26-17)23-15-9-14(20)21-11-22-15/h9,11-13,16-17H,8,10H2,1-7H3,(H,21,22,23)/t12-,13-,16-,17+/m1/s1 |
| InChIKey | LOSOEZBGMYZYEG-KFZJALRRSA-N |
| XLogP | 4.42 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|