C14H20ClN3O3 — CID 86618724
[(3aS,4R,6R,6aR)-4-[(6-chloropyrimidin-4-yl)-methylamino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol (PubChem CID 86618724) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-[(6-chloropyrimidin-4-yl)-methylamino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aS,4R,6R,6aR)-4-[(6-chloropyrimidin-4-yl)-methylamino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 86618724 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-[(6-chloropyrimidin-4-yl)-methylamino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
| SMILES | CN(c1cc(Cl)ncn1)[C@@H]1C[C@H](CO)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C14H20ClN3O3/c1-14(2)20-12-8(6-19)4-9(13(12)21-14)18(3)11-5-10(15)16-7-17-11/h5,7-9,12-13,19H,4,6H2,1-3H3/t8-,9-,12-,13+/m1/s1 |
| InChIKey | SJZGKKUILDXXMI-RQSQLSILSA-N |
| XLogP | 1.47 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |