C18H24O5 — CID 86618864
ethyl 6-formyl-7-[4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]heptanoate (PubChem CID 86618864) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl 6-formyl-7-[4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]heptanoate.
| Compound Name | ethyl 6-formyl-7-[4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]heptanoate |
|---|---|
| PubChem CID | 86618864 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | ethyl 6-formyl-7-[4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCC(C=O)CC1C=CC(OC)=CC1=C=O |
| InChI | InChI=1S/C18H24O5/c1-3-23-18(21)7-5-4-6-14(12-19)10-15-8-9-17(22-2)11-16(15)13-20/h8-9,11-12,14-15H,3-7,10H2,1-2H3 |
| InChIKey | AXUBJPCACLWOPL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|