C25H31BrF3N3O3 — CID 86619286
N-[(4-bromophenyl)methyl]-5-pentyl-N-piperidin-4-ylpyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 86619286) has the molecular formula C25H31BrF3N3O3 and a molecular weight of 558.44 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-5-pentyl-N-piperidin-4-ylpyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(4-bromophenyl)methyl]-5-pentyl-N-piperidin-4-ylpyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86619286 |
| Molecular Formula | C25H31BrF3N3O3 |
| Molecular Weight | 558.44 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-5-pentyl-N-piperidin-4-ylpyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(Br)cc2)C2CCNCC2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H30BrN3O.C2HF3O2/c1-2-3-4-5-18-8-11-22(26-16-18)23(28)27(21-12-14-25-15-13-21)17-19-6-9-20(24)10-7-19;3-2(4,5)1(6)7/h6-11,16,21,25H,2-5,12-15,17H2,1H3;(H,6,7) |
| InChIKey | NMRAIYFMELPAHN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|