C14H8F9NO6S — CID 86619542
ethyl 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)furo[3,2-c]pyridine-2-carboxylate (PubChem CID 86619542) has the molecular formula C14H8F9NO6S and a molecular weight of 489.27 g/mol. Its IUPAC name is ethyl 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)furo[3,2-c]pyridine-2-carboxylate.
| Compound Name | ethyl 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)furo[3,2-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 86619542 |
| Molecular Formula | C14H8F9NO6S |
| Molecular Weight | 489.27 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | ethyl 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)furo[3,2-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccncc2c1OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H8F9NO6S/c1-2-28-10(25)9-8(6-5-24-4-3-7(6)29-9)30-31(26,27)14(22,23)12(17,18)11(15,16)13(19,20)21/h3-5H,2H2,1H3 |
| InChIKey | KTLADQLSXYYOMO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 95.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|