C19H26ClN3O2 — CID 86619793
tert-butyl (3S)-3-[[2-(chloromethyl)benzimidazol-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 86619793) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[2-(chloromethyl)benzimidazol-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[2-(chloromethyl)benzimidazol-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86619793 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | tert-butyl (3S)-3-[[2-(chloromethyl)benzimidazol-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Cn2c(CCl)nc3ccccc32)C1 |
| InChI | InChI=1S/C19H26ClN3O2/c1-19(2,3)25-18(24)22-10-6-7-14(12-22)13-23-16-9-5-4-8-15(16)21-17(23)11-20/h4-5,8-9,14H,6-7,10-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | AGIQNWBPGHXQOQ-CQSZACIVSA-N |
| XLogP | 4.42 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|