About dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane
dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane (PubChem CID 86620274) has the molecular formula C2BF3K2O3
and a molecular weight of 218.02 g/mol. Its IUPAC name is dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane.
Molecular Properties
| Compound Name | dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane |
| PubChem CID | 86620274 |
| Molecular Formula | C2BF3K2O3 |
| Molecular Weight | 218.02 g/mol |
| Exact Mass | 217.92 |
| IUPAC Name | dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane |
| SMILES | [K+].[K+].[O-]B([O-])OC(F)=C(F)F |
| InChI | InChI=1S/C2BF3O3.2K/c4-1(5)2(6)9-3(7)8;;/q-2;2*+1 |
| InChIKey | MCHMXLLGCGCRLT-UHFFFAOYSA-N |
| XLogP | -7.25 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.02 |
| LogP ≤ 5 | -7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane?
The IUPAC name of dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane (CID 86620274) is dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane.
What is the SMILES notation for dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane?
The canonical SMILES for dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane is [K+].[K+].[O-]B([O-])OC(F)=C(F)F.
What is the InChIKey of dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane?
The InChIKey is MCHMXLLGCGCRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2BF3O3.2K/c4-1(5)2(6)9-3(7)8;;/q-2;2*+1.
What are the key properties of dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane?
dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane has a molecular weight of 218.02 g/mol, XLogP of -7.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;dioxido(1,2,2-trifluoroethenoxy)borane is sourced from PubChem (CID 86620274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).