C14H23IN2O3 — CID 86620571
1-[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]-5-iodopent-4-en-1-ol (PubChem CID 86620571) has the molecular formula C14H23IN2O3 and a molecular weight of 394.25 g/mol. Its IUPAC name is 1-[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]-5-iodopent-4-en-1-ol.
| Compound Name | 1-[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]-5-iodopent-4-en-1-ol |
|---|---|
| PubChem CID | 86620571 |
| Molecular Formula | C14H23IN2O3 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]-5-iodopent-4-en-1-ol |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=N[C@H]1C(O)CCC=CI |
| InChI | InChI=1S/C14H23IN2O3/c1-9(2)11-13(19-3)17-12(14(16-11)20-4)10(18)7-5-6-8-15/h6,8-12,18H,5,7H2,1-4H3/t10?,11-,12+/m1/s1 |
| InChIKey | JNJHISNORRBCIU-SAIIYOCFSA-N |
| XLogP | 2.57 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|