C21H20Cl2N4O — CID 86620972
1,4-dichloro-N-[3-(piperidin-1-ylmethyl)phenyl]phthalazine-6-carboxamide (PubChem CID 86620972) has the molecular formula C21H20Cl2N4O and a molecular weight of 415.32 g/mol. Its IUPAC name is 1,4-dichloro-N-[3-(piperidin-1-ylmethyl)phenyl]phthalazine-6-carboxamide.
| Compound Name | 1,4-dichloro-N-[3-(piperidin-1-ylmethyl)phenyl]phthalazine-6-carboxamide |
|---|---|
| PubChem CID | 86620972 |
| Molecular Formula | C21H20Cl2N4O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1,4-dichloro-N-[3-(piperidin-1-ylmethyl)phenyl]phthalazine-6-carboxamide |
| SMILES | O=C(Nc1cccc(CN2CCCCC2)c1)c1ccc2c(Cl)nnc(Cl)c2c1 |
| InChI | InChI=1S/C21H20Cl2N4O/c22-19-17-8-7-15(12-18(17)20(23)26-25-19)21(28)24-16-6-4-5-14(11-16)13-27-9-2-1-3-10-27/h4-8,11-12H,1-3,9-10,13H2,(H,24,28) |
| InChIKey | NKMAFVMPDMMBIY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |