C33H29N3O — CID 86621142
2-(benzhydrylideneamino)-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one (PubChem CID 86621142) has the molecular formula C33H29N3O and a molecular weight of 483.62 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one.
| Compound Name | 2-(benzhydrylideneamino)-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one |
|---|---|
| PubChem CID | 86621142 |
| Molecular Formula | C33H29N3O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 2-(benzhydrylideneamino)-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one |
| SMILES | CN1CC2CN(c3ccc4c(c3)C(=O)c3cc(N=C(c5ccccc5)c5ccccc5)ccc3-4)CC2C1 |
| InChI | InChI=1S/C33H29N3O/c1-35-18-24-20-36(21-25(24)19-35)27-13-15-29-28-14-12-26(16-30(28)33(37)31(29)17-27)34-32(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-17,24-25H,18-21H2,1H3 |
| InChIKey | YABFOVKVCFSTDO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|