C20H24FN3O4S — CID 86621232
ethyl (E)-3-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]prop-2-enoate (PubChem CID 86621232) has the molecular formula C20H24FN3O4S and a molecular weight of 421.49 g/mol. Its IUPAC name is ethyl (E)-3-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 86621232 |
| Molecular Formula | C20H24FN3O4S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | ethyl (E)-3-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(-c2ccc(F)cc2)nc(N(C)S(C)(=O)=O)nc1C(C)C |
| InChI | InChI=1S/C20H24FN3O4S/c1-6-28-17(25)12-11-16-18(13(2)3)22-20(24(4)29(5,26)27)23-19(16)14-7-9-15(21)10-8-14/h7-13H,6H2,1-5H3/b12-11+ |
| InChIKey | HVZAHIOXVSROKW-VAWYXSNFSA-N |
| XLogP | 3.38 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|