C16H16F3N3O7S — CID 86621587
1-[3-cyano-5-ethoxycarbonyl-6-(trifluoromethylsulfonyloxy)-2-pyridinyl]piperidine-4-carboxylic acid (PubChem CID 86621587) has the molecular formula C16H16F3N3O7S and a molecular weight of 451.38 g/mol. Its IUPAC name is 1-[3-cyano-5-ethoxycarbonyl-6-(trifluoromethylsulfonyloxy)-2-pyridinyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-cyano-5-ethoxycarbonyl-6-(trifluoromethylsulfonyloxy)-2-pyridinyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 86621587 |
| Molecular Formula | C16H16F3N3O7S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 1-[3-cyano-5-ethoxycarbonyl-6-(trifluoromethylsulfonyloxy)-2-pyridinyl]piperidine-4-carboxylic acid |
| SMILES | CCOC(=O)c1cc(C#N)c(N2CCC(C(=O)O)CC2)nc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O7S/c1-2-28-15(25)11-7-10(8-20)12(22-5-3-9(4-6-22)14(23)24)21-13(11)29-30(26,27)16(17,18)19/h7,9H,2-6H2,1H3,(H,23,24) |
| InChIKey | ANFZVNMQMKKQNA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 146.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|