C37H41N5O7S — CID 86622139
methyl (2S)-2-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]-2-[3-[[N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidoyl]amino]phenyl]acetate (PubChem CID 86622139) has the molecular formula C37H41N5O7S and a molecular weight of 699.83 g/mol. Its IUPAC name is methyl (2S)-2-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]-2-[3-[[N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidoyl]amino]phenyl]acetate.
| Compound Name | methyl (2S)-2-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]-2-[3-[[N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 86622139 |
| Molecular Formula | C37H41N5O7S |
| Molecular Weight | 699.83 g/mol |
| Exact Mass | 699.27 |
| IUPAC Name | methyl (2S)-2-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]-2-[3-[[N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidoyl]amino]phenyl]acetate |
| SMILES | COC(=O)[C@@H](NC(=O)c1cccn(Cc2ccccc2)c1=O)c1cccc(NC(N)=NS(=O)(=O)c2c(C)c(C)c3c(c2C)CCC(C)(C)O3)c1 |
| InChI | InChI=1S/C37H41N5O7S/c1-22-23(2)32(24(3)28-17-18-37(4,5)49-31(22)28)50(46,47)41-36(38)39-27-15-10-14-26(20-27)30(35(45)48-6)40-33(43)29-16-11-19-42(34(29)44)21-25-12-8-7-9-13-25/h7-16,19-20,30H,17-18,21H2,1-6H3,(H,40,43)(H3,38,39,41)/t30-/m0/s1 |
| InChIKey | PNOIAHDAEPCJGV-PMERELPUSA-N |
| XLogP | 4.69 |
| TPSA | 171.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.83 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|