C19H23F3O3S — CID 86622665
[4-(3,5-dimethyl-1-adamantyl)phenyl] trifluoromethanesulfonate (PubChem CID 86622665) has the molecular formula C19H23F3O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is [4-(3,5-dimethyl-1-adamantyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(3,5-dimethyl-1-adamantyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86622665 |
| Molecular Formula | C19H23F3O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [4-(3,5-dimethyl-1-adamantyl)phenyl] trifluoromethanesulfonate |
| SMILES | CC12CC3CC(C)(C1)CC(c1ccc(OS(=O)(=O)C(F)(F)F)cc1)(C3)C2 |
| InChI | InChI=1S/C19H23F3O3S/c1-16-7-13-8-17(2,10-16)12-18(9-13,11-16)14-3-5-15(6-4-14)25-26(23,24)19(20,21)22/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | LFJCUZOLNJUBDV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|