About benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine
benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine (PubChem CID 86622716) has the molecular formula C30H38Cl2N2O7S2
and a molecular weight of 673.68 g/mol. Its IUPAC name is benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine.
Molecular Properties
| Compound Name | benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine |
| PubChem CID | 86622716 |
| Molecular Formula | C30H38Cl2N2O7S2 |
| Molecular Weight | 673.68 g/mol |
| Exact Mass | 672.15 |
| IUPAC Name | benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine |
| SMILES | Cc1c(OC2CCN(CC3CCNCC3)CC2)ccc(Cl)c1Cl.O=S(=O)(O)c1ccccc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C18H26Cl2N2O.2C6H6O3S/c1-13-17(3-2-16(19)18(13)20)23-15-6-10-22(11-7-15)12-14-4-8-21-9-5-14;2*7-10(8,9)6-4-2-1-3-5-6/h2-3,14-15,21H,4-12H2,1H3;2*1-5H,(H,7,8,9) |
| InChIKey | RWLKYSUFZFIGSB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 673.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine?
The IUPAC name of benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine (CID 86622716) is benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine.
What is the SMILES notation for benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine?
The canonical SMILES for benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine is Cc1c(OC2CCN(CC3CCNCC3)CC2)ccc(Cl)c1Cl.O=S(=O)(O)c1ccccc1.O=S(=O)(O)c1ccccc1.
What is the InChIKey of benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine?
The InChIKey is RWLKYSUFZFIGSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26Cl2N2O.2C6H6O3S/c1-13-17(3-2-16(19)18(13)20)23-15-6-10-22(11-7-15)12-14-4-8-21-9-5-14;2*7-10(8,9)6-4-2-1-3-5-6/h2-3,14-15,21H,4-12H2,1H3;2*1-5H,(H,7,8,9).
What are the key properties of benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine?
benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine has a molecular weight of 673.68 g/mol, XLogP of 6.01, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonic acid;4-(3,4-dichloro-2-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine is sourced from PubChem (CID 86622716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).