C8H13NO3 — CID 86622851
(2R)-2-methyl-4-oxo-4-(prop-2-enylamino)butanoic acid (PubChem CID 86622851) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (2R)-2-methyl-4-oxo-4-(prop-2-enylamino)butanoic acid.
| Compound Name | (2R)-2-methyl-4-oxo-4-(prop-2-enylamino)butanoic acid |
|---|---|
| PubChem CID | 86622851 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2R)-2-methyl-4-oxo-4-(prop-2-enylamino)butanoic acid |
| SMILES | C=CCNC(=O)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C8H13NO3/c1-3-4-9-7(10)5-6(2)8(11)12/h3,6H,1,4-5H2,2H3,(H,9,10)(H,11,12)/t6-/m1/s1 |
| InChIKey | AULYMTRDNCAPGL-ZCFIWIBFSA-N |
| XLogP | 0.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|