C25H34ClN5O3Si — CID 86622888
4-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]-5-(4-chlorophenyl)-1,4-dihydroimidazole-4,5-dicarboxamide (PubChem CID 86622888) has the molecular formula C25H34ClN5O3Si and a molecular weight of 516.12 g/mol. Its IUPAC name is 4-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]-5-(4-chlorophenyl)-1,4-dihydroimidazole-4,5-dicarboxamide.
| Compound Name | 4-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]-5-(4-chlorophenyl)-1,4-dihydroimidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 86622888 |
| Molecular Formula | C25H34ClN5O3Si |
| Molecular Weight | 516.12 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 4-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]-5-(4-chlorophenyl)-1,4-dihydroimidazole-4,5-dicarboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCNc1ccc(NC(=O)C2N=CNC2(C(N)=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H34ClN5O3Si/c1-24(2,3)35(4,5)34-15-14-28-19-10-12-20(13-11-19)31-22(32)21-25(23(27)33,30-16-29-21)17-6-8-18(26)9-7-17/h6-13,16,21,28H,14-15H2,1-5H3,(H2,27,33)(H,29,30)(H,31,32) |
| InChIKey | OYSXLWUBCCSMFS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.12 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|