C12H20O5 — CID 86623179
propan-2-yl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 86623179) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is propan-2-yl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | propan-2-yl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 86623179 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | propan-2-yl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CC(C)OC(=O)C[C@H]1C[C@@H](C=O)OC(C)(C)O1 |
| InChI | InChI=1S/C12H20O5/c1-8(2)15-11(14)6-9-5-10(7-13)17-12(3,4)16-9/h7-10H,5-6H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | ZZLRZKSMTBSPAK-ZJUUUORDSA-N |
| XLogP | 1.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|