C49H50F6 — CID 86623196
3-[cyclopenta-1,3-dien-1-yl-bis[3-(trifluoromethyl)phenyl]methyl]-3,4,4,5,5,6,6,7-octamethylpentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,11,13,15,17,19-hexaene (PubChem CID 86623196) has the molecular formula C49H50F6 and a molecular weight of 752.93 g/mol. Its IUPAC name is 3-[cyclopenta-1,3-dien-1-yl-bis[3-(trifluoromethyl)phenyl]methyl]-3,4,4,5,5,6,6,7-octamethylpentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,11,13,15,17,19-hexaene.
| Compound Name | 3-[cyclopenta-1,3-dien-1-yl-bis[3-(trifluoromethyl)phenyl]methyl]-3,4,4,5,5,6,6,7-octamethylpentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,11,13,15,17,19-hexaene |
|---|---|
| PubChem CID | 86623196 |
| Molecular Formula | C49H50F6 |
| Molecular Weight | 752.93 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | 3-[cyclopenta-1,3-dien-1-yl-bis[3-(trifluoromethyl)phenyl]methyl]-3,4,4,5,5,6,6,7-octamethylpentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1,11,13,15,17,19-hexaene |
| SMILES | CC12C(=C3Cc4ccccc4C3=C3C=CCCC31)C(C)(C(C1=CC=CC1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C49H50F6/c1-42(2)43(3,4)45(7)39-26-14-13-25-37(39)40-36-24-12-9-17-30(36)27-38(40)41(45)46(8,44(42,5)6)47(31-18-10-11-19-31,32-20-15-22-34(28-32)48(50,51)52)33-21-16-23-35(29-33)49(53,54)55/h9-13,15-18,20-25,28-29,39H,14,19,26-27H2,1-8H3 |
| InChIKey | PQKCJZDNAMYEHF-UHFFFAOYSA-N |
| XLogP | 14.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.93 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |