C10H19N3O3S2 — CID 86623291
2-amino-6-(propylamino)-4,5,6,7-tetrahydro-3H-1,3-benzothiazole-2-sulfonic acid (PubChem CID 86623291) has the molecular formula C10H19N3O3S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-amino-6-(propylamino)-4,5,6,7-tetrahydro-3H-1,3-benzothiazole-2-sulfonic acid.
| Compound Name | 2-amino-6-(propylamino)-4,5,6,7-tetrahydro-3H-1,3-benzothiazole-2-sulfonic acid |
|---|---|
| PubChem CID | 86623291 |
| Molecular Formula | C10H19N3O3S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-amino-6-(propylamino)-4,5,6,7-tetrahydro-3H-1,3-benzothiazole-2-sulfonic acid |
| SMILES | CCCNC1CCC2=C(C1)SC(N)(S(=O)(=O)O)N2 |
| InChI | InChI=1S/C10H19N3O3S2/c1-2-5-12-7-3-4-8-9(6-7)17-10(11,13-8)18(14,15)16/h7,12-13H,2-6,11H2,1H3,(H,14,15,16) |
| InChIKey | ZVFFKSTVBHXVKY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|